Hydroxytyrosol, a potent antioxidant polyphenol derived from olives, is celebrated for its health-promoting properties. Highly valued in the nutraceutical, cosmetic, and pharmaceutical sectors, it contributes to the development of products that support well-being and skin health.
描述
| Hydroxytyrosol Chemical Properties |
| Boiling point | 355.4??27.0 ??C(Predicted) |
| density | 1.321??0.06 g/cm3(Predicted) |
| refractive index | 1.5810-1.5860 |
| storage temp. | -20??C |
| solubility | Acetonitrile (Slightly), DMSO (Slightly), Ethyl Acetate (Sparingly), Methanol (Slightly) |
| pka | 9.72??0.10(Predicted) |
| form | Solid |
| color | Colourless to Yellow Sticky Oil |
| BRN | 2208118 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
| InChIKey | JUUBCHWRXWPFFH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCO)C=C1O |
| LogP | 0.020 (est) |
| CAS DataBase Reference | 10597-60-1(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29072990 |



