Polyglutamic acid (y-PGA), also known as natto gum, is a high molecular peptide polymer synthesized from several glutamic acid monomers through microbial fermentation. It is rich in glutamic acid, glucose, protein and minerals. , vitamins and other biologically active substances.
Polyglutamic acid (??-PGA) is a sticky substance that was first discovered in ??Natto??. It is currently widely used in agricultural production and is called a new biostimulant. It is fully water-soluble, biodegradable, edible, and non-toxic. It is a biopolymer produced by microbial fermentation.
描述
Polyglutamic Acid CAS# 25513-46-6
| Polyglutamic acid Basic information |
| Product Name: | Polyglutamic acid |
| Synonyms: | POLY-L-GLUTAMIC ACID 15’000-50’000 SODIUM SALT;POLY-L-GLUTAMIC ACID 2’000-15’000;POLY-L-GLUTAMIC ACID 50’000-100’000 SODIUM SALT;L-GLU-(L-GLU)N-L-GLU;glutamicacidpolymer;POLY-L;gamma-poly(L-glutamic acid) macromolecule;G-poly glutamic acid |
| CAS: | 25513-46-6 |
| MF: | C5H9NO4 |
| MW: | 147.13 |
| EINECS: | 200-293-7 |
| Product Categories: | Amino Acids;Homopolymers;Polyamino Acids;25513-46-6 |
| Mol File: | 25513-46-6.mol |
 |
|
| Polyglutamic acid Chemical Properties |
| storage temp. | ?20??C |
| InChI | InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/s3 |
| InChIKey | WHUUTDBJXJRKMK-ZJPLZJKBNA-N |
| SMILES | [C@@H](N)(C(=O)O)CCC(=O)O |&1:0,r| |
| Safety Information |
| WGK Germany | 3 |
| RTECS | MA1700000 |
| F | 3-10 |
