Ectoine is a naturally occurring osmoprotectant, a cyclic amino acid derivative that offers exceptional cell-stabilizing properties. Highly valued in cosmetics and pharmaceuticals, it enhances product efficacy by maintaining cell integrity under various environmental stresses.
描述
| Ectoine Chemical Properties |
| Melting point | ~280?? |
| alpha | D20 +140?? (c = 1.0 in methanol) |
| Boiling point | 381.5??35.0 ??C(Predicted) |
| density | 1.37 |
| storage temp. | 2-8??C |
| solubility | methanol: 20?mg/mL, clear, colorless |
| pka | 3.14??0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Water : 250 mg/mL (1758.58 mM) |
| BRN | 7288977 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | WQXNXVUDBPYKBA-YFKPBYRVSA-N |
| SMILES | C1(C)=NCC[C@@H](C(O)=O)N1 |
