Puerarin, also known as pueraria flavonoids, is a kind of flavonoid glycoside extracted from the roots of Pueraria alba or Pueraria thomsonii and is also one of the main effective ingredients of Pueraria lobata. That Pueraria lobate was used to treat diseases has already been recorded in China??s ancient medical books such as Shen Nong??s Materia Medica, Treatise on Miscellaneous Diseases and Medical Dictionary.
Kanzu root is widely distributed in our country and of rich resources. It has been reported that puerarin could be extracted from Pueraria lobata (Wild.) Ohwi, Radix Pueraria thomsonii, Pueraria omeiensiswanget Tang, Pueraria edulis Pamp and Pueraria phaseoloides, but the content of puerarin differs.
Pueraria has a great value for nutrition and medicine and was considered the south ginseng of China. Puerarin has been widespread concerned over our country for its use of food and medicine in recent years.
描述
Puerarin CAS# 3681-99-0
| Puerarin Basic information |
| Product Name: | Puerarin |
| Synonyms: | Puerain;PUERARIN(P);8-beta-d-glucopyranosyl-7-hydroxy-3-(4-hydroxyphenyl)-4h-1-benzopyran-4-on;Puerqarin;PUERARIN WITH HPLC;PUERARIN;8-GLUCOSYLDAIDZEIN;7-HYDROXY-3-[4-HYDROXYPHENYL]-1-BENZOPYRAN-4-ONE 8-[BETA-D-GLUCOPYRANOSIDE |
| CAS: | 3681-99-0 |
| MF: | C21H20O9 |
| MW: | 416.38 |
| EINECS: | 609-296-1 |
| Product Categories: | natural product;Inhibitors;Iso-Flavones;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Herb extract;Natural Plant Extract;3681-99-0 |
| Mol File: | 3681-99-0.mol |
 |
|
| Puerarin Chemical Properties |
| Melting point | 187-189??C |
| Boiling point | 688.0??55.0 ??C(Predicted) |
| density | 1.614??0.06 g/cm3(Predicted) |
| storage temp. | 2-8??C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 6.46??0.20(Predicted) |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Soluble in DMSO or DMF. Slightly soluble in water or ethanol |
| ??max | 303nm(MeOH)(lit.) |
| BRN | 64198 |
| InChIKey | HKEAFJYKMMKDOR-NCHCSYJDSA-N |
| SMILES | OC1=CC=C2C(C(C3C=CC(O)=CC=3)=COC2=C1[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)=O |&1:18,19,20,22,24,r| |
| LogP | 0.408 (est) |
| CAS DataBase Reference | 3681-99-0(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 22-24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | UO5216000 |
| F | 10 |
| HS Code | 29389090 |
